[(2R,3R,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4,5-dihydroxy-2-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 34bdea90-361a-44fb-9ebe-c8cc57e45360 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [(2R,3R,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4,5-dihydroxy-2-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)OC(=O)C=CC6=CC=C(C=C6)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H]2[C@@H]([C@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)OC(=O)/C=C\C6=CC=C(C=C6)O)O)O)O |
InChI | InChI=1S/C36H36O18/c1-14-26(43)28(45)30(47)35(50-14)49-13-23-33(53-24(42)9-4-15-2-6-17(37)7-3-15)29(46)31(48)36(52-23)54-34-27(44)25-21(41)11-18(38)12-22(25)51-32(34)16-5-8-19(39)20(40)10-16/h2-12,14,23,26,28-31,33,35-41,43,45-48H,13H2,1H3/b9-4-/t14-,23+,26-,28-,29-,30+,31+,33-,35+,36-/m0/s1 |
InChI Key | HLWFQXZBFQLASS-GBNUMAQDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H36O18 |
Molecular Weight | 756.70 g/mol |
Exact Mass | 756.19016430 g/mol |
Topological Polar Surface Area (TPSA) | 292.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
![2D Structure of [(2R,3R,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4,5-dihydroxy-2-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3R,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4,5-dihydroxy-2-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/255041c0-861e-11ee-9772-c97e3e5fdf07.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.75% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.21% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 99.11% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.31% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 96.76% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 95.27% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.71% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.21% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.42% | 99.17% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.45% | 95.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.18% | 95.56% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 88.42% | 80.78% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.50% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.50% | 99.15% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.87% | 96.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.66% | 94.80% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 85.39% | 98.35% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.34% | 97.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.59% | 91.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.34% | 95.78% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.98% | 95.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.87% | 97.36% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.65% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos variabilis |
PubChem | 162939810 |
LOTUS | LTS0135744 |
wikiData | Q105030347 |