Glybomine A
| Internal ID | 70681437-1431-4cb1-bc88-c52ba85673b0 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 2,5-dimethoxy-3-methyl-9H-carbazole |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H15NO2/c1-9-7-10-12(8-14(9)18-3)16-11-5-4-6-13(17-2)15(10)11/h4-8,16H,1-3H3 |
| InChI Key | QZDZVZYFGAXQRH-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.110278721 g/mol |
| Topological Polar Surface Area (TPSA) | 34.30 Ų |
| XlogP | 3.70 |
| 2,5-dimethoxy-3-methyl-9H-carbazole |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2535 | P11166 | Glucose transporter | 95.67% | 98.75% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 95.23% | 89.32% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.07% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.47% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.87% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.08% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.71% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.30% | 93.31% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.39% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.11% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.40% | 91.11% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.26% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.26% | 89.62% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.08% | 96.00% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.06% | 92.98% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 85.73% | 100.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.42% | 97.21% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.15% | 94.75% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.25% | 90.20% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 81.17% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycosmis pentaphylla |
| PubChem | 11207217 |
| LOTUS | LTS0226528 |
| wikiData | Q105231908 |