2',4',6'-Trihydroxy-4-methoxychalcone
| Internal ID | 418e9e86-82ff-467e-b35c-b9877236bcb7 |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C=CC(=O)C2=C(C=C(C=C2O)O)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)/C=C/C(=O)C2=C(C=C(C=C2O)O)O |
| InChI | InChI=1S/C16H14O5/c1-21-12-5-2-10(3-6-12)4-7-13(18)16-14(19)8-11(17)9-15(16)20/h2-9,17,19-20H,1H3/b7-4+ |
| InChI Key | DGUBZDXYXXUHTJ-QPJJXVBHSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 3.10 |
| CHEMBL133588 |
| SCHEMBL11349226 |
| CHEBI:178321 |
| BDBM50235135 |
| LMPK12120265 |
| 4-METHOXYL-2',4',6'-TRIHYDROXYCHALCONE |
| 4-METHOXYL-2'',4'',6''-TRIHYDROXYCHALCONE |
| (E)-3-(4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.87% | 91.11% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 95.67% | 96.12% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 95.31% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.95% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 93.07% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.81% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.50% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.21% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.61% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.77% | 99.15% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.70% | 95.50% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.65% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.14% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Populus tremula |
| Wyethia glabra |
| PubChem | 13990811 |
| LOTUS | LTS0150105 |
| wikiData | Q76423512 |