2,4,5-Trihydroxy-1-methoxyanthracene-9,10-dione
| Internal ID | c15c1f16-6445-49c2-aaa2-40f4e8a44f8d |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | 2,4,5-trihydroxy-1-methoxyanthracene-9,10-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H10O6/c1-21-15-9(18)5-8(17)11-12(15)13(19)6-3-2-4-7(16)10(6)14(11)20/h2-5,16-18H,1H3 |
| InChI Key | PYEXJCYQXUYFSF-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.04773803 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.83% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.79% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.00% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.77% | 99.15% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.26% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.98% | 99.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.77% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.41% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.42% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.36% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.31% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.67% | 89.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.46% | 96.67% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.26% | 90.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.66% | 93.03% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.70% | 90.24% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.10% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cinchona pubescens |
| PubChem | 86142836 |
| LOTUS | LTS0088415 |
| wikiData | Q105216559 |