[(2S,3S,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (4aS,6aR,6aS,6bS,8S,8aR,9R,10R,11R,12aS,14bS)-8,11-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
| Internal ID | a1b59589-5ca1-4897-b091-6dcc97e47646 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | [(2S,3S,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (4aS,6aR,6aS,6bS,8S,8aR,9R,10R,11R,12aS,14bS)-8,11-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC(=O)C34CCC(CC3C5=CCC6C7(CC(C(C(C7C(CC6(C5(CC4)C)C)O)(C)CO)OC8C(C(C(C(O8)CO)O)O)O)O)C)(C)C)O)O)O)O)O |
| SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2[C@H]([C@H](CO[C@H]2OC(=O)[C@@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C[C@@H]([C@@H]7[C@]6(C[C@H]([C@@H]([C@@]7(C)CO)O[C@@H]8[C@H]([C@@H]([C@H]([C@@H](O8)CO)O)O)O)O)C)O)C)[C@@H]3CC(CC4)(C)C)C)O)O)O)O)O |
| InChI | InChI=1S/C47H76O19/c1-20-28(53)31(56)33(58)38(62-20)64-35-29(54)25(52)18-61-40(35)66-41(60)47-12-10-42(2,3)14-22(47)21-8-9-27-43(4)15-24(51)37(65-39-34(59)32(57)30(55)26(17-48)63-39)44(5,19-49)36(43)23(50)16-46(27,7)45(21,6)11-13-47/h8,20,22-40,48-59H,9-19H2,1-7H3/t20-,22+,23+,24-,25+,26+,27-,28-,29+,30+,31+,32-,33-,34+,35+,36-,37+,38+,39-,40+,43+,44+,45-,46+,47+/m1/s1 |
| InChI Key | JUXWBGYLESHCHB-UMRJLOMVSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C47H76O19 |
| Molecular Weight | 945.10 g/mol |
| Exact Mass | 944.49808019 g/mol |
| Topological Polar Surface Area (TPSA) | 315.00 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 96.05% | 97.36% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.89% | 96.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.51% | 96.77% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.39% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.88% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.92% | 97.25% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.29% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.12% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.04% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.50% | 95.56% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.56% | 86.92% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.45% | 95.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.85% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.27% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Madhuca longifolia |
| PubChem | 163104636 |
| LOTUS | LTS0205167 |
| wikiData | Q105135515 |