2,3,4-Tribromo-6-(2,4-dibromophenoxy)phenol
| Internal ID | 3b244349-e200-4d1c-b34a-e77931163eee |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylethers > Bromodiphenyl ethers |
| IUPAC Name | 2,3,4-tribromo-6-(2,4-dibromophenoxy)phenol |
| SMILES (Canonical) | C1=CC(=C(C=C1Br)Br)OC2=CC(=C(C(=C2O)Br)Br)Br |
| SMILES (Isomeric) | C1=CC(=C(C=C1Br)Br)OC2=CC(=C(C(=C2O)Br)Br)Br |
| InChI | InChI=1S/C12H5Br5O2/c13-5-1-2-8(6(14)3-5)19-9-4-7(15)10(16)11(17)12(9)18/h1-4,18H |
| InChI Key | FSIJSYKTNOYMTQ-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C12H5Br5O2 |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 579.61654 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 6.60 |
| 75A72MZ8WK |
| 80246-24-8 |
| Phenol, 2,3,4-tribromo-6-(2,4-dibromophenoxy)- |
| 6-(2,4-Bis(bromanyl)phenoxy)-2,3,4-tris(bromanyl)phenol |
| RefChem:81304 |
| UNII-75A72MZ8WK |
| CHEMBL462942 |
| SCHEMBL5531128 |
| SCHEMBL29469595 |
| CTK3E5867 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
7400 nM |
IC50 |
PMID: 7494145
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.90% | 91.11% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 89.88% | 83.57% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.66% | 89.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.07% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.18% | 99.15% |
| CHEMBL3194 | P02766 | Transthyretin | 87.05% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.28% | 95.56% |
| CHEMBL240 | Q12809 | HERG | 84.38% | 89.76% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.82% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.50% | 90.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.77% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Achillea leptophylla |
| Aldama cordifolia |
| Cordiera macrophylla |
| Dioscorea futschauensis |
| Dorstenia barnimiana |
| Petrosedum forsterianum |
| Rubia yunnanensis |
| Uvaria mocoli |
| Verbascum georgicum |
| Zieria chevalieri |
| PubChem | 11978695 |
| NPASS | NPC153580 |
| ChEMBL | CHEMBL462942 |
| LOTUS | LTS0177744 |
| wikiData | Q82305355 |