2,3,10-Trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-11-one
| Internal ID | 4347dce9-39a6-4a50-a57d-bab16e505f14 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives |
| IUPAC Name | 2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-11-one |
| SMILES (Canonical) | COC1=CC2=CN3CCC4=CC(=C(C=C4C3=CC2=CC1=O)OC)OC |
| SMILES (Isomeric) | COC1=CC2=CN3CCC4=CC(=C(C=C4C3=CC2=CC1=O)OC)OC |
| InChI | InChI=1S/C20H19NO4/c1-23-18-9-14-11-21-5-4-12-8-19(24-2)20(25-3)10-15(12)16(21)6-13(14)7-17(18)22/h6-11H,4-5H2,1-3H3 |
| InChI Key | CESULBHOOHSIKO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.13140809 g/mol |
| Topological Polar Surface Area (TPSA) | 48.00 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
![2D Structure of 2,3,10-Trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-11-one](https://plantaedb.com/storage/docs/compounds/2023/11/2310-trimethoxy-56-dihydroisoquinolino21-bisoquinolin-11-one.jpg "2D Structure of 2,3,10-Trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-11-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 97.81% | 92.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.18% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.98% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.79% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.48% | 93.40% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.72% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.44% | 85.14% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 91.42% | 95.12% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.68% | 89.63% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.99% | 95.56% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 88.69% | 92.38% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.57% | 94.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 86.08% | 91.00% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 83.69% | 95.53% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.32% | 90.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.09% | 94.78% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.72% | 95.89% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.62% | 82.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Annona glabra |
| PubChem | 163071177 |
| LOTUS | LTS0201535 |
| wikiData | Q104956034 |