2,3-Dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridine
| Internal ID | b9db87ec-b430-45eb-b1fc-e05a6d8ae403 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Phenanthridines and derivatives |
| IUPAC Name | 2,3-dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridine |
| SMILES (Canonical) | COC1=C(C=C2C3=C(C4=CC5=C(C=C4C=C3)OCO5)N=CC2=C1)OC |
| SMILES (Isomeric) | COC1=C(C=C2C3=C(C4=CC5=C(C=C4C=C3)OCO5)N=CC2=C1)OC |
| InChI | InChI=1S/C20H15NO4/c1-22-16-6-12-9-21-20-13(14(12)7-17(16)23-2)4-3-11-5-18-19(8-15(11)20)25-10-24-18/h3-9H,10H2,1-2H3 |
| InChI Key | LMLYRQCAWCJVML-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 49.80 Ų |
| XlogP | 4.40 |
| 18034-03-2 |
| CHEMBL521226 |
| SCHEMBL11742867 |
| DTXSID60304657 |
| NSC-166719 |
![2D Structure of 2,3-Dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridine](https://plantaedb.com/storage/docs/compounds/2023/11/23-dimethoxy-13benzodioxolo56-cphenanthridine.jpg "2D Structure of 2,3-Dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.57% | 96.77% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.90% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.76% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.46% | 92.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.02% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.81% | 86.33% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 91.75% | 85.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.60% | 94.45% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 91.53% | 85.30% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.20% | 94.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.17% | 96.00% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 89.44% | 89.44% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.94% | 89.62% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 85.61% | 92.50% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 85.44% | 95.12% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.42% | 92.94% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 85.21% | 92.38% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.18% | 95.78% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.98% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.19% | 95.56% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.96% | 94.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.69% | 95.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.41% | 96.09% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.24% | 82.67% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.69% | 97.36% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.12% | 90.00% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 80.53% | 92.51% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.21% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum integrifoliolum |
| Zanthoxylum madagascariense |
| Zanthoxylum myrianthum |
| Zanthoxylum rhoifolium |
| PubChem | 296524 |
| LOTUS | LTS0114391 |
| wikiData | Q82050742 |