2,3-Dihydro-9-hydroxy-7H-furo[3,2-g][1]benzopyran-7-one
| Internal ID | d8bec60e-60cd-4f2b-8295-f212599685a0 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Furanocoumarins > Psoralens |
| IUPAC Name | 9-hydroxy-2,3-dihydrofuro[3,2-g]chromen-7-one |
| SMILES (Canonical) | C1COC2=C1C=C3C=CC(=O)OC3=C2O |
| SMILES (Isomeric) | C1COC2=C1C=C3C=CC(=O)OC3=C2O |
| InChI | InChI=1S/C11H8O4/c12-8-2-1-6-5-7-3-4-14-10(7)9(13)11(6)15-8/h1-2,5,13H,3-4H2 |
| InChI Key | GWDMSCZQYHAETO-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.04225873 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 1.60 |
| 2,3-Dihydro-9-hydroxy-7H-furo[3,2-g][1]benzopyran-7-one |
| 2,3-Dihydroxanthotoxol |
| 9-Hydroxy-2H-furo[3,2-g]chromen-7(3H)-one |
| 9-hydroxy-2,3-dihydrofuro[3,2-g]chromen-7-one |
| 9-hydroxy-2,3-dihydro-7h-furo[3,2-g]chromen-7-one |
| 7H-Furo(3,2-g)(1)benzopyran-7-one, 2,3-dihydro-9-hydroxy- |
| 7H-Furo[3,2-g][1]benzopyran-7-one, 2,3-dihydro-9-hydroxy- |
| EINECS 268-548-5 |
| 2,3-Dihydro-9-hydroxy-7H-furo(3,2-g)(1)benzopyran-7-one |
| 4',5'-Dihydro-8-Hydroxy Psoralen |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.81% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.32% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.47% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.95% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.94% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.93% | 93.99% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.74% | 93.40% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.30% | 90.71% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.19% | 85.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.54% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.45% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.34% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aegle marmelos |
| PubChem | 106648 |
| LOTUS | LTS0093567 |
| wikiData | Q72466434 |