22R-hydroxycholesterol
| Internal ID | 1d13e19c-495d-4b4c-bf53-42ba5194880f |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Bile acids, alcohols and derivatives > Hydroxy bile acids, alcohols and derivatives > Dihydroxy bile acids, alcohols and derivatives |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17R)-17-[(2S,3R)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES (Canonical) | CC(C)CCC(C(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)O |
| SMILES (Isomeric) | C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)[C@@H](CCC(C)C)O |
| InChI | InChI=1S/C27H46O2/c1-17(2)6-11-25(29)18(3)22-9-10-23-21-8-7-19-16-20(28)12-14-26(19,4)24(21)13-15-27(22,23)5/h7,17-18,20-25,28-29H,6,8-16H2,1-5H3/t18-,20-,21-,22+,23-,24-,25+,26-,27+/m0/s1 |
| InChI Key | RZPAXNJLEKLXNO-GFKLAVDKSA-N |
| Popularity | 398 references in papers |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 402.349780706 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 7.00 |
| 17954-98-2 |
| 22R-hydroxycholesterol |
| 22beta-Hydroxycholesterol |
| (22R)-22-Hydroxycholesterol |
| cholest-5-en-3beta,22R-diol |
| (22R)-Hydroxycholesterol |
| 22R-OHC |
| (3beta,22R)-Cholest-5-ene-3,22-diol |
| CHEMBL422904 |
| (3S,8S,9S,10R,13S,14S,17R)-17-[(2S,3R)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1741186 | P51449 | Nuclear receptor ROR-gamma |
20 nM 20 nM |
EC50 EC50 |
via Super-PRED
via Super-PRED |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.12% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.90% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.95% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.77% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.78% | 91.11% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.54% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.39% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.02% | 90.17% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 89.43% | 94.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.63% | 97.09% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.53% | 98.05% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.11% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.97% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.15% | 90.71% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.06% | 97.79% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.68% | 94.45% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.88% | 98.59% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.06% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.82% | 96.43% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.86% | 89.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Narthecium ossifragum |
| Ruscus aculeatus |
| PubChem | 167685 |
| LOTUS | LTS0081524 |
| wikiData | Q4631298 |