2,2':3',2''-Terthiophene
| Internal ID | 5df35606-3994-4f91-b959-08c668049259 |
| Taxonomy | Organoheterocyclic compounds > Bi- and oligothiophenes |
| IUPAC Name | 2,3-dithiophen-2-ylthiophene |
| SMILES (Canonical) | C1=CSC(=C1)C2=C(SC=C2)C3=CC=CS3 |
| SMILES (Isomeric) | C1=CSC(=C1)C2=C(SC=C2)C3=CC=CS3 |
| InChI | InChI=1S/C12H8S3/c1-3-10(13-6-1)9-5-8-15-12(9)11-4-2-7-14-11/h1-8H |
| InChI Key | SBVKMIQOXJYJIM-UHFFFAOYSA-N |
| Popularity | 378 references in papers |
| Molecular Formula | C12H8S3 |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 247.97881378 g/mol |
| Topological Polar Surface Area (TPSA) | 84.70 Ų |
| XlogP | 4.30 |
| 2,3-dithiophen-2-ylthiophene |
| 111744-23-1 |
| NSC700222 |
| CHEBI:50079 |
| SCHEMBL147273 |
| 2,3-bis(2-thienyl)thiophene |
| CHEMBL482785 |
| DTXSID90327899 |
| SBVKMIQOXJYJIM-UHFFFAOYSA-N |
| AKOS024368118 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 86.15% | 98.95% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 85.18% | 85.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.99% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.82% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.80% | 95.93% |
| CHEMBL3568 | P29475 | Nitric-oxide synthase, brain | 80.44% | 95.46% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eclipta prostrata |
| Olea europaea |
| PubChem | 395532 |
| LOTUS | LTS0046449 |
| wikiData | Q105272599 |