[(1aR,2'S,3aS,4S,5S,5'R,6S,7R,7aS,7bS)-7-acetyloxy-5'-(furan-3-yl)-2'-hydroxy-5,7a,7b-trimethylspiro[2,3,3a,5,6,7-hexahydro-1aH-naphtho[1,2-b]oxirene-4,3'-oxolane]-6-yl] acetate
| Internal ID | 97c11eaf-afa8-43eb-95b6-c75f29f2c33e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
| IUPAC Name | [(1aR,2'S,3aS,4S,5S,5'R,6S,7R,7aS,7bS)-7-acetyloxy-5'-(furan-3-yl)-2'-hydroxy-5,7a,7b-trimethylspiro[2,3,3a,5,6,7-hexahydro-1aH-naphtho[1,2-b]oxirene-4,3'-oxolane]-6-yl] acetate |
| SMILES (Canonical) | CC1C(C(C2(C(C13CC(OC3O)C4=COC=C4)CCC5C2(O5)C)C)OC(=O)C)OC(=O)C |
| SMILES (Isomeric) | C[C@@H]1[C@@H]([C@@H]([C@@]2([C@@H]([C@@]13C[C@@H](O[C@@H]3O)C4=COC=C4)CC[C@@H]5[C@]2(O5)C)C)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C24H32O8/c1-12-19(29-13(2)25)20(30-14(3)26)22(4)17(6-7-18-23(22,5)32-18)24(12)10-16(31-21(24)27)15-8-9-28-11-15/h8-9,11-12,16-21,27H,6-7,10H2,1-5H3/t12-,16-,17+,18-,19+,20+,21+,22+,23-,24-/m1/s1 |
| InChI Key | UIEULHLNJMJHQZ-BVCMDOFXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20971797 g/mol |
| Topological Polar Surface Area (TPSA) | 108.00 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.08% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.15% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.78% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.54% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.31% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.30% | 91.19% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.98% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.90% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.70% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.60% | 97.14% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.73% | 95.50% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.55% | 94.80% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.35% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.26% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.20% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.11% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.08% | 96.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.91% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Croton eluteria |
| PubChem | 11826455 |
| LOTUS | LTS0206827 |
| wikiData | Q105273323 |