[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | 43c76628-5148-4810-8ec5-4c76b8820fe6 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanidin 3-O-p-coumaroyl glycosides > Anthocyanidin 3-O-6-p-coumaroyl glycosides |
IUPAC Name | [(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C([O+]=C4C=C(C=C(C4=C3)OC5C(C(C(C(O5)CO)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1/C=C/C(=O)OC[C@@H]2[C@H]([C@H]([C@H]([C@@H](O2)OC3=C([O+]=C4C=C(C=C(C4=C3)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C36H36O20/c37-11-24-28(45)30(47)32(49)35(55-24)53-22-9-15(38)8-21-16(22)10-23(34(52-21)14-6-19(41)27(44)20(42)7-14)54-36-33(50)31(48)29(46)25(56-36)12-51-26(43)4-2-13-1-3-17(39)18(40)5-13/h1-10,24-25,28-33,35-37,45-50H,11-12H2,(H5-,38,39,40,41,42,43,44)/p+1/t24-,25-,28-,29-,30+,31-,32-,33-,35-,36-/m1/s1 |
InChI Key | ZTJRGVZWJAJAER-WEPPENFBSA-O |
Popularity | 0 references in papers |
Molecular Formula | C36H37O20+ |
Molecular Weight | 789.70 g/mol |
Exact Mass | 789.18781857 g/mol |
Topological Polar Surface Area (TPSA) | 327.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.85% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.51% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.26% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 96.84% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.59% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.94% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.57% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.52% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.91% | 99.15% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.72% | 83.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.85% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.11% | 94.73% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.91% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.31% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.47% | 92.62% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.98% | 80.78% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.69% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia splendens |
PubChem | 154496255 |
LOTUS | LTS0130415 |
wikiData | Q105382978 |