[(10R,11S)-3,4,5,17,18,19,22,23,34,35-decahydroxy-10,11-dimethyl-8,14,26,31-tetraoxo-10-[(1S)-1-[(3R,4R)-4,5,6,7-tetrahydroxy-3-methyl-1-oxo-4H-isochromen-3-yl]-1-(3,4,5-trihydroxybenzoyl)oxyethyl]-9,13,25,32-tetraoxaheptacyclo[25.8.0.02,7.015,20.021,30.024,29.028,33]pentatriaconta-1(35),2,4,6,15,17,19,21,23,27,29,33-dodecaen-11-yl] 3,4,5-trihydroxybenzoate
Internal ID | 1c4d6233-94f2-47fa-b779-5233a97839e2 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(10R,11S)-3,4,5,17,18,19,22,23,34,35-decahydroxy-10,11-dimethyl-8,14,26,31-tetraoxo-10-[(1S)-1-[(3R,4R)-4,5,6,7-tetrahydroxy-3-methyl-1-oxo-4H-isochromen-3-yl]-1-(3,4,5-trihydroxybenzoyl)oxyethyl]-9,13,25,32-tetraoxaheptacyclo[25.8.0.02,7.015,20.021,30.024,29.028,33]pentatriaconta-1(35),2,4,6,15,17,19,21,23,27,29,33-dodecaen-11-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | CC1(COC(=O)C2=CC(=C(C(=C2C3=C(C(=C4C5=C3C(=O)OC6=C(C(=C(C7=C(C(=C(C=C7C(=O)OC1(C)C(C)(C8(C(C9=C(C(=C(C=C9C(=O)O8)O)O)O)O)C)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O)O)C(=C56)C(=O)O4)O)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O |
SMILES (Isomeric) | C[C@@]1(COC(=O)C2=CC(=C(C(=C2C3=C(C(=C4C5=C3C(=O)OC6=C(C(=C(C7=C(C(=C(C=C7C(=O)O[C@@]1(C)[C@](C)([C@]8([C@@H](C9=C(C(=C(C=C9C(=O)O8)O)O)O)O)C)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O)O)C(=C56)C(=O)O4)O)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O |
InChI | InChI=1S/C59H42O34/c1-56(90-49(80)13-5-18(60)34(67)19(61)6-13)12-87-51(82)15-9-22(64)36(69)39(72)25(15)28-32-30-31-33(55(86)89-46(30)44(77)42(28)75)29(43(76)45(78)47(31)88-54(32)85)26-16(10-23(65)37(70)40(26)73)53(84)93-58(56,3)59(4,92-50(81)14-7-20(62)35(68)21(63)8-14)57(2)48(79)27-17(52(83)91-57)11-24(66)38(71)41(27)74/h5-11,48,60-79H,12H2,1-4H3/t48-,56+,57-,58-,59+/m1/s1 |
InChI Key | AZBTYCNYKJMLCX-FAOOYVDXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C59H42O34 |
Molecular Weight | 1294.90 g/mol |
Exact Mass | 1294.1557484 g/mol |
Topological Polar Surface Area (TPSA) | 589.00 Ų |
XlogP | 3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.07% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.81% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.19% | 89.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.72% | 89.34% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 93.60% | 94.42% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.50% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.71% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.49% | 91.49% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.91% | 99.23% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.59% | 93.03% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.58% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.08% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.58% | 93.04% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.81% | 97.09% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 85.77% | 96.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.90% | 91.07% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.87% | 85.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.72% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.72% | 97.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.22% | 90.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.42% | 83.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.60% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Punica granatum |
PubChem | 162851938 |
LOTUS | LTS0072488 |
wikiData | Q104921588 |