(8R,21S)-16,27-dimethoxy-29,31-dioxa-7,22-diazaoctacyclo[19.9.3.14,30.110,14.115,19.03,8.025,33.028,32]hexatriaconta-1(30),2,4(34),10(36),11,13,15,17,19(35),25,27,32-dodecaen-13-ol
| Internal ID | 13eb7b90-a0cb-4c8f-ba97-4073389620a5 |
| Taxonomy | Lignans, neolignans and related compounds |
| IUPAC Name | (8R,21S)-16,27-dimethoxy-29,31-dioxa-7,22-diazaoctacyclo[19.9.3.14,30.110,14.115,19.03,8.025,33.028,32]hexatriaconta-1(30),2,4(34),10(36),11,13,15,17,19(35),25,27,32-dodecaen-13-ol |
| SMILES (Canonical) | COC1=C2C=C(CC3C4=C5C(=C(C=C4CCN3)OC)OC6=C(O5)C=C7C(CC8=CC2=C(C=C8)O)NCCC7=C6)C=C1 |
| SMILES (Isomeric) | COC1=C2C=C(C[C@H]3C4=C5C(=C(C=C4CCN3)OC)OC6=C(O5)C=C7[C@@H](CC8=CC2=C(C=C8)O)NCCC7=C6)C=C1 |
| InChI | InChI=1S/C34H32N2O5/c1-38-28-6-4-19-12-24(28)23-11-18(3-5-27(23)37)13-25-22-17-30-29(15-20(22)7-9-35-25)40-33-31(39-2)16-21-8-10-36-26(14-19)32(21)34(33)41-30/h3-6,11-12,15-17,25-26,35-37H,7-10,13-14H2,1-2H3/t25-,26+/m1/s1 |
| InChI Key | CTOXZASNPMHYIO-FTJBHMTQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C34H32N2O5 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.23112213 g/mol |
| Topological Polar Surface Area (TPSA) | 81.20 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.71% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.68% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.55% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.43% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.39% | 97.09% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.33% | 96.21% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.08% | 92.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.66% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.98% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.83% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.97% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.26% | 85.14% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.07% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.33% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.44% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.06% | 89.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 85.03% | 95.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.97% | 99.17% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 83.07% | 91.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.17% | 99.23% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.94% | 89.62% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.08% | 99.15% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.82% | 97.21% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.44% | 96.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.14% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pachygone ovata |
| PubChem | 163026003 |
| LOTUS | LTS0224504 |
| wikiData | Q104969962 |