2-[(Z)-hex-3-enyl]-8-methoxy-1,2,3,4-tetrahydrobenzo[c]quinolizin-6-one
| Internal ID | fc9a4820-a15e-4a02-a4de-18fbcb31adaa |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 2-[(Z)-hex-3-enyl]-8-methoxy-1,2,3,4-tetrahydrobenzo[c]quinolizin-6-one |
| SMILES (Canonical) | CCC=CCCC1CCC2=CC(=O)C3=C(N2C1)C=CC(=C3)OC |
| SMILES (Isomeric) | CC/C=C\CCC1CCC2=CC(=O)C3=C(N2C1)C=CC(=C3)OC |
| InChI | InChI=1S/C20H25NO2/c1-3-4-5-6-7-15-8-9-16-12-20(22)18-13-17(23-2)10-11-19(18)21(16)14-15/h4-5,10-13,15H,3,6-9,14H2,1-2H3/b5-4- |
| InChI Key | BRAQVHKZUKAFMR-PLNGDYQASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.188529040 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
![2D Structure of 2-[(Z)-hex-3-enyl]-8-methoxy-1,2,3,4-tetrahydrobenzo[c]quinolizin-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-z-hex-3-enyl-8-methoxy-1234-tetrahydrobenzocquinolizin-6-one.jpg "2D Structure of 2-[(Z)-hex-3-enyl]-8-methoxy-1,2,3,4-tetrahydrobenzo[c]quinolizin-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.44% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.43% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.03% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.73% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.98% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.66% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.73% | 93.40% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.65% | 92.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.79% | 99.17% |
| CHEMBL1871 | P10275 | Androgen Receptor | 89.49% | 96.43% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.64% | 98.59% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.84% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.38% | 86.33% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.39% | 93.31% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.57% | 92.94% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.43% | 95.89% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 82.90% | 91.96% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.77% | 95.53% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.49% | 99.18% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.30% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dictyoloma vandellianum |
| PubChem | 22298571 |
| LOTUS | LTS0035289 |
| wikiData | Q104944676 |