2-Sec-butylpyrazine
| Internal ID | 4f832ab3-8e9b-4f88-8f27-1d7ef2a3f75f |
| Taxonomy | Organoheterocyclic compounds > Diazines > Pyrazines |
| IUPAC Name | 2-butan-2-ylpyrazine |
| SMILES (Canonical) | CCC(C)C1=NC=CN=C1 |
| SMILES (Isomeric) | CCC(C)C1=NC=CN=C1 |
| InChI | InChI=1S/C8H12N2/c1-3-7(2)8-6-9-4-5-10-8/h4-7H,3H2,1-2H3 |
| InChI Key | NFFQZEXYZVZKNN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.100048391 g/mol |
| Topological Polar Surface Area (TPSA) | 25.80 Ų |
| XlogP | 1.30 |
| 2-(sec-Butyl)pyrazine |
| 29460-93-3 |
| 124070-52-6 |
| 2-SECBUTYL PYRAZINE |
| 2-butan-2-ylpyrazine |
| 2-(1-Methylpropyl)pyrazine |
| Pyrazine, 2-(1-methylpropyl)- |
| 2-(butan-2-yl)pyrazine |
| sec-butylpyrazine |
| 1-methylpropylpyrazine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.20% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.32% | 94.73% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.29% | 93.10% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.49% | 90.17% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.72% | 93.65% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 82.35% | 89.92% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.19% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.11% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.34% | 90.00% |
| CHEMBL2424504 | P29375 | Lysine-specific demethylase 5A | 81.04% | 99.23% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.98% | 97.23% |
| CHEMBL2094128 | P24941 | Cyclin-dependent kinase 2/cyclin A | 80.57% | 97.25% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.00% | 87.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Coffea arabica |
| PubChem | 528053 |
| LOTUS | LTS0269582 |
| wikiData | Q72507242 |