2-octadecyl-1H-indol-3-ol
Internal ID | 0e8e9317-f185-4bba-bb45-28e85d3aae92 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Hydroxyindoles |
IUPAC Name | 2-octadecyl-1H-indol-3-ol |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCC1=C(C2=CC=CC=C2N1)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCC1=C(C2=CC=CC=C2N1)O |
InChI | InChI=1S/C26H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-25-26(28)23-20-18-19-21-24(23)27-25/h18-21,27-28H,2-17,22H2,1H3 |
InChI Key | AYPYUZXAFNVUEC-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C26H43NO |
Molecular Weight | 385.60 g/mol |
Exact Mass | 385.334464995 g/mol |
Topological Polar Surface Area (TPSA) | 36.00 Ų |
XlogP | 11.00 |
Fistulosin |
octadecyl 3-hydroxyindole |
CHEBI:185477 |
1,2-Dihydro-2-octadecyl-3H-indol-3-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.26% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.84% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 96.24% | 92.08% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 93.35% | 87.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.94% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.70% | 96.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 92.05% | 91.71% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 89.87% | 91.81% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.59% | 93.99% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 87.88% | 97.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.40% | 95.56% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.12% | 97.79% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.43% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.03% | 94.73% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 83.55% | 96.25% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.89% | 89.63% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.69% | 93.31% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.14% | 96.37% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.58% | 99.23% |
CHEMBL5979 | P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | 81.49% | 85.40% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 80.61% | 85.94% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.52% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium fistulosum |
PubChem | 11574561 |
LOTUS | LTS0066696 |
wikiData | Q104921317 |