2-O-(4-O-Methyl-alpha-D-glucopyranuronosyl)-D-xylose
Internal ID | b5b75b7f-0f65-42d6-89ac-09cc383751a6 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | (2S,3S,4R,5R,6S)-4,5-dihydroxy-3-methoxy-6-[(2R,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl]oxyoxane-2-carboxylic acid |
SMILES (Canonical) | COC1C(C(C(OC1C(=O)O)OC(C=O)C(C(CO)O)O)O)O |
SMILES (Isomeric) | CO[C@H]1[C@@H]([C@H]([C@H](O[C@@H]1C(=O)O)O[C@@H](C=O)[C@H]([C@@H](CO)O)O)O)O |
InChI | InChI=1S/C12H20O11/c1-21-9-7(17)8(18)12(23-10(9)11(19)20)22-5(3-14)6(16)4(15)2-13/h3-10,12-13,15-18H,2H2,1H3,(H,19,20)/t4-,5+,6+,7-,8-,9+,10+,12+/m1/s1 |
InChI Key | ZDDGWONHTPYERI-MOEYFMCOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H20O11 |
Molecular Weight | 340.28 g/mol |
Exact Mass | 340.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 183.00 Ų |
XlogP | -4.20 |
SCHEMBL7151088 |
DTXSID001237159 |
7382-52-7 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.65% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 87.68% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.52% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.80% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.91% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.69% | 94.73% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.16% | 96.47% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.23% | 98.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.79% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.40% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.12% | 86.92% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.59% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ananas comosus |
PubChem | 88100827 |
LOTUS | LTS0254211 |
wikiData | Q105372082 |