2-((Methylthiomethyl)Dithio)Pyridine-N-Oxide
Internal ID | ef69465a-8bd5-46ec-9253-660794ea551c |
Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinium derivatives |
IUPAC Name | 2-(methylsulfanylmethyldisulfanyl)-1-oxidopyridin-1-ium |
SMILES (Canonical) | CSCSSC1=CC=CC=[N+]1[O-] |
SMILES (Isomeric) | CSCSSC1=CC=CC=[N+]1[O-] |
InChI | InChI=1S/C7H9NOS3/c1-10-6-11-12-7-4-2-3-5-8(7)9/h2-5H,6H2,1H3 |
InChI Key | MUHWXZGNCHKLDY-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C7H9NOS3 |
Molecular Weight | 219.40 g/mol |
Exact Mass | 218.98462743 g/mol |
Topological Polar Surface Area (TPSA) | 101.00 Ų |
XlogP | 1.50 |
2-[(Methylthio)methyldithio]pyridine 1-oxide |
2-[(Methylthiomethyl)dithio]pyridine-N-oxide |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2039 | P27338 | Monoamine oxidase B | 91.52% | 92.51% |
CHEMBL2581 | P07339 | Cathepsin D | 90.96% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.09% | 95.56% |
CHEMBL240 | Q12809 | HERG | 86.61% | 89.76% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.98% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.33% | 96.09% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 82.25% | 93.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium stipitatum |
PubChem | 45267926 |
NPASS | NPC56856 |
ChEMBL | CHEMBL559906 |
LOTUS | LTS0152929 |
wikiData | Q105172386 |