[2-Methyl-6-(11-oxododecyl)piperidin-3-yl] acetate
| Internal ID | 2fc12941-1fd6-4505-bea6-e1f0bed8a9a3 |
| Taxonomy | Alkaloids and derivatives |
| IUPAC Name | [2-methyl-6-(11-oxododecyl)piperidin-3-yl] acetate |
| SMILES (Canonical) | CC1C(CCC(N1)CCCCCCCCCCC(=O)C)OC(=O)C |
| SMILES (Isomeric) | CC1C(CCC(N1)CCCCCCCCCCC(=O)C)OC(=O)C |
| InChI | InChI=1S/C20H37NO3/c1-16(22)12-10-8-6-4-5-7-9-11-13-19-14-15-20(17(2)21-19)24-18(3)23/h17,19-21H,4-15H2,1-3H3 |
| InChI Key | AACOWOOKWQCRBQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.27734404 g/mol |
| Topological Polar Surface Area (TPSA) | 55.40 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
![2D Structure of [2-Methyl-6-(11-oxododecyl)piperidin-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/2-methyl-6-11-oxododecylpiperidin-3-yl-acetate.jpg "2D Structure of [2-Methyl-6-(11-oxododecyl)piperidin-3-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.73% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.61% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.13% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.76% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.48% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.34% | 94.45% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.39% | 97.79% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.70% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.25% | 97.09% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.84% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.25% | 95.50% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 85.08% | 95.92% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.91% | 94.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.37% | 96.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.14% | 97.25% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.12% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senna spectabilis |
| PubChem | 85370760 |
| LOTUS | LTS0075346 |
| wikiData | Q103815947 |