2-Methyl-4-allyl-phenol
| Internal ID | 80e3a16b-1dca-40a5-a13a-5678784ff24f |
| Taxonomy | Benzenoids > Phenols > Cresols > Ortho cresols |
| IUPAC Name | 2-methyl-4-prop-2-enylphenol |
| SMILES (Canonical) | CC1=C(C=CC(=C1)CC=C)O |
| SMILES (Isomeric) | CC1=C(C=CC(=C1)CC=C)O |
| InChI | InChI=1S/C10H12O/c1-3-4-9-5-6-10(11)8(2)7-9/h3,5-7,11H,1,4H2,2H3 |
| InChI Key | BEYRARVOHDHKTG-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.088815002 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 3.00 |
| SCHEMBL219534 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.52% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.41% | 91.11% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 91.87% | 90.24% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.36% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.66% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.19% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.65% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.65% | 86.33% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.90% | 93.65% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.70% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.12% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chrysanthemum oreastrum |
| Clinopodium congestum |
| Ocimum tenuiflorum |
| PubChem | 13660470 |
| LOTUS | LTS0058105 |
| wikiData | Q104933780 |