2-Methyl-1-pentene
| Internal ID | 50e77580-72f9-4b33-97f6-2df1ba1271b2 |
| Taxonomy | Hydrocarbons > Unsaturated hydrocarbons > Branched unsaturated hydrocarbons |
| IUPAC Name | 2-methylpent-1-ene |
| SMILES (Canonical) | CCCC(=C)C |
| SMILES (Isomeric) | CCCC(=C)C |
| InChI | InChI=1S/C6H12/c1-4-5-6(2)3/h2,4-5H2,1,3H3 |
| InChI Key | WWUVJRULCWHUSA-UHFFFAOYSA-N |
| Popularity | 200 references in papers |
| Molecular Formula | C6H12 |
| Molecular Weight | 84.16 g/mol |
| Exact Mass | 84.093900383 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 3.00 |
| 763-29-1 |
| 2-Methylpent-1-ene |
| 2-Methylpentene |
| 4-Methyl-4-pentene |
| 1-Pentene, 2-methyl- |
| 2-Methyl-pentene-1 |
| OKC25O38MC |
| NSC-73908 |
| EINECS 212-108-7 |
| NSC 73908 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.87% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.36% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.46% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.13% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.04% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Basella alba |
| PubChem | 12986 |
| LOTUS | LTS0187258 |
| wikiData | Q27285703 |