2-methoxy-5-[(E)-5-(4-methoxyphenoxy)pent-3-en-1-ynyl]phenol
Internal ID | 6f1c1423-ef65-4675-938b-2bd5877b3124 |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | 2-methoxy-5-[(E)-5-(4-methoxyphenoxy)pent-3-en-1-ynyl]phenol |
SMILES (Canonical) | COC1=CC=C(C=C1)OCC=CC#CC2=CC(=C(C=C2)OC)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)OC/C=C/C#CC2=CC(=C(C=C2)OC)O |
InChI | InChI=1S/C19H18O4/c1-21-16-8-10-17(11-9-16)23-13-5-3-4-6-15-7-12-19(22-2)18(20)14-15/h3,5,7-12,14,20H,13H2,1-2H3/b5-3+ |
InChI Key | GCOPERJEGNDWNY-HWKANZROSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H18O4 |
Molecular Weight | 310.30 g/mol |
Exact Mass | 310.12050905 g/mol |
Topological Polar Surface Area (TPSA) | 47.90 Ų |
XlogP | 4.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.79% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.41% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 95.10% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.68% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.19% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.03% | 93.99% |
CHEMBL2535 | P11166 | Glucose transporter | 89.64% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.51% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.24% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.12% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.71% | 95.56% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 87.15% | 97.53% |
CHEMBL240 | Q12809 | HERG | 84.70% | 89.76% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.96% | 91.07% |
CHEMBL1907 | P15144 | Aminopeptidase N | 81.71% | 93.31% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.60% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.13% | 95.89% |
CHEMBL2487 | P05067 | Beta amyloid A4 protein | 80.72% | 96.74% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.37% | 90.24% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.36% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asparagus officinalis |
PubChem | 11243832 |
LOTUS | LTS0179988 |
wikiData | Q105006372 |