2-Methoxy-4-(7-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-2-yl)phenol
| Internal ID | f2e0ce7d-aea9-4fe2-bab5-9ca851fb2557 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 2-methoxy-4-(7-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-2-yl)phenol |
| SMILES (Canonical) | CC1C(OC2=C1C=C(C=C2OC)CC=C)C3=CC(=C(C=C3)O)OC |
| SMILES (Isomeric) | CC1C(OC2=C1C=C(C=C2OC)CC=C)C3=CC(=C(C=C3)O)OC |
| InChI | InChI=1S/C20H22O4/c1-5-6-13-9-15-12(2)19(24-20(15)18(10-13)23-4)14-7-8-16(21)17(11-14)22-3/h5,7-12,19,21H,1,6H2,2-4H3 |
| InChI Key | CPRYHVRGHCAOEE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 47.90 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.44% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.03% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.14% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.49% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.06% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.52% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.61% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.74% | 98.95% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.36% | 95.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.91% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.72% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.30% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.76% | 89.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.77% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Myristica fragrans |
| Virola surinamensis |
| PubChem | 162938795 |
| LOTUS | LTS0193440 |
| wikiData | Q104967718 |