2-Methoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-1-one
| Internal ID | ce451298-6d95-430d-b063-d8d5bbf8459c |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Phenanthridines and derivatives |
| IUPAC Name | 2-methoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-1-one |
| SMILES (Canonical) | CN1C=C2C(=CC=C(C2=O)OC)C3=C1C4=CC5=C(C=C4C=C3)OCO5 |
| SMILES (Isomeric) | CN1C=C2C(=CC=C(C2=O)OC)C3=C1C4=CC5=C(C=C4C=C3)OCO5 |
| InChI | InChI=1S/C20H15NO4/c1-21-9-15-12(5-6-16(23-2)20(15)22)13-4-3-11-7-17-18(25-10-24-17)8-14(11)19(13)21/h3-9H,10H2,1-2H3 |
| InChI Key | RSCIYYHIBVZXDI-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 48.00 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of 2-Methoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-methoxy-12-methyl-13benzodioxolo56-cphenanthridin-1-one.jpg "2D Structure of 2-Methoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-1-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.66% | 96.77% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.57% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.83% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.50% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.38% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.13% | 96.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.28% | 89.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.24% | 91.11% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 89.60% | 92.38% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.58% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.53% | 89.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.30% | 92.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.25% | 91.49% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.23% | 96.00% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 86.23% | 95.53% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.22% | 94.42% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 86.03% | 80.78% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 84.47% | 95.12% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.02% | 95.89% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.75% | 96.67% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.95% | 93.40% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.67% | 94.75% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 81.82% | 92.50% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 81.46% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.70% | 98.75% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 80.67% | 92.51% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Macleaya cordata |
| Zanthoxylum zanthoxyloides |
| PubChem | 9951230 |
| LOTUS | LTS0185614 |
| wikiData | Q105244536 |