2-Hydroxyplatyphyllide
Internal ID | 5930edf6-f0f4-4563-a266-86163a55153d |
Taxonomy | Organoheterocyclic compounds > Benzofurans > Benzofuranones |
IUPAC Name | (1R,11R)-6-hydroxy-11-prop-1-en-2-yl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-one |
SMILES (Canonical) | CC(=C)C1CCC2=C3C1OC(=O)C3=CC(=C2)O |
SMILES (Isomeric) | CC(=C)[C@H]1CCC2=C3[C@@H]1OC(=O)C3=CC(=C2)O |
InChI | InChI=1S/C14H14O3/c1-7(2)10-4-3-8-5-9(15)6-11-12(8)13(10)17-14(11)16/h5-6,10,13,15H,1,3-4H2,2H3/t10-,13-/m1/s1 |
InChI Key | BUSWPFRBQXQTLO-ZWNOBZJWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H14O3 |
Molecular Weight | 230.26 g/mol |
Exact Mass | 230.094294304 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 2.90 |
72145-19-8 |
(1R,11R)-6-Hydroxy-11-prop-1-en-2-yl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-one |
AKOS040761006 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.55% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.72% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.66% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.61% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.88% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.95% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.78% | 89.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 85.77% | 95.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.76% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.66% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.54% | 99.23% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.87% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.36% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligularia dentata |
Ligularia fischeri |
Ligularia macrophylla |
Ligularia przewalskii |
Ligularia songarica |
Ligularia veitchiana |
PubChem | 14681768 |
LOTUS | LTS0037653 |
wikiData | Q104402744 |