2-(Hydroxymethyl)-6-(4-methoxyfuro[2,3-b]quinolin-7-yl)oxyoxane-3,4,5-triol
| Internal ID | e38e0820-d591-4b75-b450-4af348e48cac |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | 2-(hydroxymethyl)-6-(4-methoxyfuro[2,3-b]quinolin-7-yl)oxyoxane-3,4,5-triol |
| SMILES (Canonical) | COC1=C2C=COC2=NC3=C1C=CC(=C3)OC4C(C(C(C(O4)CO)O)O)O |
| SMILES (Isomeric) | COC1=C2C=COC2=NC3=C1C=CC(=C3)OC4C(C(C(C(O4)CO)O)O)O |
| InChI | InChI=1S/C18H19NO8/c1-24-16-9-3-2-8(6-11(9)19-17-10(16)4-5-25-17)26-18-15(23)14(22)13(21)12(7-20)27-18/h2-6,12-15,18,20-23H,7H2,1H3 |
| InChI Key | MANGJQNDTWAGAR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H19NO8 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.11106656 g/mol |
| Topological Polar Surface Area (TPSA) | 135.00 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
![2D Structure of 2-(Hydroxymethyl)-6-(4-methoxyfuro[2,3-b]quinolin-7-yl)oxyoxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/2-hydroxymethyl-6-4-methoxyfuro23-bquinolin-7-yloxyoxane-345-triol.jpg "2D Structure of 2-(Hydroxymethyl)-6-(4-methoxyfuro[2,3-b]quinolin-7-yl)oxyoxane-3,4,5-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.36% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.46% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.90% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.49% | 96.00% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 91.38% | 95.83% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.80% | 95.93% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.63% | 99.17% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.87% | 91.49% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.25% | 86.92% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.87% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.71% | 94.73% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 82.75% | 95.12% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.65% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.37% | 92.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.66% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.66% | 97.09% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.36% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Solidago canadensis |
| PubChem | 74927927 |
| LOTUS | LTS0209680 |
| wikiData | Q105160430 |