2-Hydroxy-N-[2-(4-methoxyphenyl)ethyl]benzamide
| Internal ID | 0bb34798-d909-45db-ba6b-5fc302d569cd |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Salicylic acid and derivatives > Salicylamides |
| IUPAC Name | 2-hydroxy-N-[2-(4-methoxyphenyl)ethyl]benzamide |
| SMILES (Canonical) | COC1=CC=C(C=C1)CCNC(=O)C2=CC=CC=C2O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)CCNC(=O)C2=CC=CC=C2O |
| InChI | InChI=1S/C16H17NO3/c1-20-13-8-6-12(7-9-13)10-11-17-16(19)14-4-2-3-5-15(14)18/h2-9,18H,10-11H2,1H3,(H,17,19) |
| InChI Key | RZZOZECFGLWGQV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.12084340 g/mol |
| Topological Polar Surface Area (TPSA) | 58.60 Ų |
| XlogP | 3.30 |
| 2-HYDROXY-N-[2-(4-METHOXYPHENYL)ETHYL]BENZAMIDE |
| DTXSID50592541 |
| AKOS000213296 |
| Z30632558 |
![2D Structure of 2-Hydroxy-N-[2-(4-methoxyphenyl)ethyl]benzamide](https://plantaedb.com/storage/docs/compounds/2023/11/2-hydroxy-n-2-4-methoxyphenylethylbenzamide.jpg "2D Structure of 2-Hydroxy-N-[2-(4-methoxyphenyl)ethyl]benzamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.08% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.05% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.24% | 98.95% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 92.35% | 87.67% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.65% | 98.75% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.42% | 95.50% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.07% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.04% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.59% | 90.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 90.07% | 96.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.01% | 94.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 87.95% | 81.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.44% | 99.17% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 87.27% | 89.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.75% | 94.73% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 84.26% | 92.67% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.24% | 94.00% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.24% | 93.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aniba riparia |
| PubChem | 18107456 |
| LOTUS | LTS0191627 |
| wikiData | Q82486705 |