2-Hydroxy-5-isopropyl-8-methyl-5,6,7,8-tetrahydro-3-naphthaldehyd
Internal ID | b8d5ef59-ff6d-4a31-9a4a-9191ce3b852b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 3-hydroxy-5-methyl-8-propan-2-yl-5,6,7,8-tetrahydronaphthalene-2-carbaldehyde |
SMILES (Canonical) | CC1CCC(C2=C1C=C(C(=C2)C=O)O)C(C)C |
SMILES (Isomeric) | CC1CCC(C2=C1C=C(C(=C2)C=O)O)C(C)C |
InChI | InChI=1S/C15H20O2/c1-9(2)12-5-4-10(3)13-7-15(17)11(8-16)6-14(12)13/h6-10,12,17H,4-5H2,1-3H3 |
InChI Key | XBEBUVYOVHQSMU-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H20O2 |
Molecular Weight | 232.32 g/mol |
Exact Mass | 232.146329876 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 4.40 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 95.57% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.87% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.60% | 91.11% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 93.76% | 98.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.92% | 91.49% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.23% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.42% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.79% | 94.45% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 87.96% | 99.18% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.87% | 93.40% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 87.06% | 90.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.40% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.29% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.71% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.39% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.56% | 92.94% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 81.18% | 97.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ulmus glabra |
PubChem | 73045116 |
LOTUS | LTS0019576 |
wikiData | Q105324337 |