2'-Hydroxy-4'-Methoxychalcone
Internal ID | 65cd2e58-b6ac-4b32-aa3d-3539372cea18 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
IUPAC Name | (E)-1-(2-hydroxy-4-methoxyphenyl)-3-phenylprop-2-en-1-one |
SMILES (Canonical) | COC1=CC(=C(C=C1)C(=O)C=CC2=CC=CC=C2)O |
SMILES (Isomeric) | COC1=CC(=C(C=C1)C(=O)/C=C/C2=CC=CC=C2)O |
InChI | InChI=1S/C16H14O3/c1-19-13-8-9-14(16(18)11-13)15(17)10-7-12-5-3-2-4-6-12/h2-11,18H,1H3/b10-7+ |
InChI Key | GUNGQVJAKLIYDG-JXMROGBWSA-N |
Popularity | 31 references in papers |
Molecular Formula | C16H14O3 |
Molecular Weight | 254.28 g/mol |
Exact Mass | 254.094294304 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 4.10 |
39273-61-5 |
1-(2-hydroxy-4-methoxyphenyl)-3-phenylprop-2-en-1-one |
2-hydroxy-4-methoxychalcone |
CHEMBL317469 |
(2E)-1-(2-hydroxy-4-methoxyphenyl)-3-phenylprop-2-en-1-one |
(E)-1-(2-hydroxy-4-methoxyphenyl)-3-phenylprop-2-en-1-one |
NSC102053 |
5-Methoxy-2-cinnamoylphenol |
MLS001049022 |
SCHEMBL3126499 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL5393 | Q9UNQ0 | ATP-binding cassette sub-family G member 2 |
30950 nM 31020 nM |
IC50 IC50 |
PMID: 18054490
PMID: 12444673 |
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
10000 nM |
Potency |
PMID: 26863083
|
CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
12589.3 nM |
Potency |
PMID: 24456556
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
3548.1 nM |
Potency |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
35481.3 nM |
Potency |
PMID: 18278869
|
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
5623.4 nM |
Potency |
PMID: 18973387
|
CHEMBL3797 | Q13315 | Serine-protein kinase ATM |
19952.6 nM |
Potency |
PMID: 23290052
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.28% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.02% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.64% | 86.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 92.44% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.93% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.15% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.07% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.96% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 87.84% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 87.79% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.08% | 99.15% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.16% | 91.71% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.99% | 93.99% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.76% | 91.07% |
CHEMBL3194 | P02766 | Transthyretin | 81.46% | 90.71% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.91% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dalbergia sissoo |
Ononis natrix |
Oxytropis falcata |
PubChem | 5380645 |
NPASS | NPC64359 |
ChEMBL | CHEMBL317469 |
LOTUS | LTS0178072 |
wikiData | Q63393713 |