2-hydroxy-4-methoxy-1-methyl-6-oxo-3-(3,4,5,6-tetrahydroxyoxan-2-yl)oxy-2H-pyridine-3-carbonitrile
| Internal ID | 9fcfaf5c-e849-43fb-9eb8-58c5f44cebd4 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | 2-hydroxy-4-methoxy-1-methyl-6-oxo-3-(3,4,5,6-tetrahydroxyoxan-2-yl)oxy-2H-pyridine-3-carbonitrile |
| SMILES (Canonical) | CN1C(C(C(=CC1=O)OC)(C#N)OC2C(C(C(C(O2)O)O)O)O)O |
| SMILES (Isomeric) | CN1C(C(C(=CC1=O)OC)(C#N)OC2C(C(C(C(O2)O)O)O)O)O |
| InChI | InChI=1S/C13H18N2O9/c1-15-6(16)3-5(22-2)13(4-14,12(15)21)24-11-9(19)7(17)8(18)10(20)23-11/h3,7-12,17-21H,1-2H3 |
| InChI Key | JNOBKBGUTMPMPS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H18N2O9 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.10123016 g/mol |
| Topological Polar Surface Area (TPSA) | 173.00 Ų |
| XlogP | -3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.37% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.90% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.22% | 91.11% |
| CHEMBL1871 | P10275 | Androgen Receptor | 94.79% | 96.43% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.50% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.61% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.06% | 94.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.19% | 83.82% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.28% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.65% | 99.23% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.82% | 97.36% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.16% | 90.17% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.96% | 82.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acalypha indica |
| PubChem | 163010765 |
| LOTUS | LTS0188450 |
| wikiData | Q105132034 |