2-Ethyl-6-methylpyridine
| Internal ID | 4db067a8-e238-46aa-9763-051fbd2020c8 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Methylpyridines |
| IUPAC Name | 2-ethyl-6-methylpyridine |
| SMILES (Canonical) | CCC1=CC=CC(=N1)C |
| SMILES (Isomeric) | CCC1=CC=CC(=N1)C |
| InChI | InChI=1S/C8H11N/c1-3-8-6-4-5-7(2)9-8/h4-6H,3H2,1-2H3 |
| InChI Key | SFSXNVBMAODLGN-UHFFFAOYSA-N |
| Popularity | 11 references in papers |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.089149355 g/mol |
| Topological Polar Surface Area (TPSA) | 12.90 Ų |
| XlogP | 2.10 |
| 1122-69-6 |
| Pyridine, 2-ethyl-6-methyl- |
| 2-Methyl-6-ethylpyridine |
| 2-Picoline, 6-ethyl- |
| 6-Ethyl-2-picoline |
| 6-Ethyl-2-methylpyridine |
| YPG7D02E36 |
| MFCD00023531 |
| 2-ethyl-6-methyl-pyridine |
| EINECS 214-356-1 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 94.32% | 96.42% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 92.47% | 93.65% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.65% | 93.31% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.75% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.66% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.95% | 98.95% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.73% | 94.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.72% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.79% | 96.09% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.91% | 96.39% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.58% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Camellia sinensis |
| PubChem | 14287 |
| LOTUS | LTS0223538 |
| wikiData | Q63399568 |