2-Ethenyl-7-hydroxy-2,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydrophenanthren-3-one
Internal ID | 3fff7067-83d7-4751-9552-6eb1ca16aeff |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 2-ethenyl-7-hydroxy-2,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydrophenanthren-3-one |
SMILES (Canonical) | CC1(C2CCC3=CC(C(=O)CC3C2(CCC1O)C)(C)C=C)C |
SMILES (Isomeric) | CC1(C2CCC3=CC(C(=O)CC3C2(CCC1O)C)(C)C=C)C |
InChI | InChI=1S/C20H30O2/c1-6-19(4)12-13-7-8-15-18(2,3)16(21)9-10-20(15,5)14(13)11-17(19)22/h6,12,14-16,21H,1,7-11H2,2-5H3 |
InChI Key | XSAIAQPPQRTIGN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O2 |
Molecular Weight | 302.50 g/mol |
Exact Mass | 302.224580195 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 3.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.90% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 90.89% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.81% | 82.69% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 87.91% | 97.05% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.92% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.65% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.57% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.88% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.80% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.58% | 97.09% |
CHEMBL1977 | P11473 | Vitamin D receptor | 82.94% | 99.43% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.43% | 91.49% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.69% | 93.03% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.74% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.65% | 99.23% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.56% | 85.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.17% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jatropha curcas |
PubChem | 14191197 |
LOTUS | LTS0273358 |
wikiData | Q105340912 |