2'-Epifraxamoside
Internal ID | 9fccb103-f771-409b-b33c-27757f427d05 |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | (1S,3S,7S,12S,15R,16S,17S,18R,20E)-12-(3,4-dihydroxyphenyl)-20-ethylidene-16,17,18-trihydroxy-9-oxo-2,4,10,13,19-pentaoxatricyclo[13.3.1.13,7]icos-5-ene-6-carboxylic acid |
SMILES (Canonical) | CC=C1C2CC(=O)OCC(OCC3C(C(C(C(O3)OC1OC=C2C(=O)O)O)O)O)C4=CC(=C(C=C4)O)O |
SMILES (Isomeric) | C/C=C/1\[C@@H]2CC(=O)OC[C@@H](OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)O[C@@H]1OC=C2C(=O)O)O)O)O)C4=CC(=C(C=C4)O)O |
InChI | InChI=1S/C24H28O13/c1-2-11-12-6-18(27)34-8-16(10-3-4-14(25)15(26)5-10)33-9-17-19(28)20(29)21(30)24(36-17)37-23(11)35-7-13(12)22(31)32/h2-5,7,12,16-17,19-21,23-26,28-30H,6,8-9H2,1H3,(H,31,32)/b11-2+/t12-,16+,17+,19+,20-,21+,23-,24-/m0/s1 |
InChI Key | HYGUFHOLLCKYHM-BASFMAEZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C24H28O13 |
Molecular Weight | 524.50 g/mol |
Exact Mass | 524.15299094 g/mol |
Topological Polar Surface Area (TPSA) | 202.00 Ų |
XlogP | -1.40 |
2'-Epifraxamoside |
BDBM50378457 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.21% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.09% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.26% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.59% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 92.26% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.05% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.06% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.01% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.45% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.12% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.79% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.18% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.71% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.05% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jasminum grandiflorum |
PubChem | 16750858 |
LOTUS | LTS0071060 |
wikiData | Q105035310 |