2''-Epifraxamoside
Internal ID | b38dbb46-f6f4-4ff7-ac62-770406dfe05e |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | methyl (1S,3S,7S,12S,15R,16S,17S,18R,20E)-12-(3,4-dihydroxyphenyl)-20-ethylidene-16,17,18-trihydroxy-9-oxo-2,4,10,13,19-pentaoxatricyclo[13.3.1.13,7]icos-5-ene-6-carboxylate |
SMILES (Canonical) | CC=C1C2CC(=O)OCC(OCC3C(C(C(C(O3)OC1OC=C2C(=O)OC)O)O)O)C4=CC(=C(C=C4)O)O |
SMILES (Isomeric) | C/C=C/1\[C@@H]2CC(=O)OC[C@@H](OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)O[C@@H]1OC=C2C(=O)OC)O)O)O)C4=CC(=C(C=C4)O)O |
InChI | InChI=1S/C25H30O13/c1-3-12-13-7-19(28)35-9-17(11-4-5-15(26)16(27)6-11)34-10-18-20(29)21(30)22(31)25(37-18)38-24(12)36-8-14(13)23(32)33-2/h3-6,8,13,17-18,20-22,24-27,29-31H,7,9-10H2,1-2H3/b12-3+/t13-,17+,18+,20+,21-,22+,24-,25-/m0/s1 |
InChI Key | QVUZRUJONIJRDT-ZDVSSOLQSA-N |
Popularity | 2 references in papers |
Molecular Formula | C25H30O13 |
Molecular Weight | 538.50 g/mol |
Exact Mass | 538.16864101 g/mol |
Topological Polar Surface Area (TPSA) | 191.00 Ų |
XlogP | -1.10 |
CHEMBL4228853 |
Methyl (1S,3S,7S,12S,15R,16S,17S,18R,20E)-12-(3,4-dihydroxyphenyl)-20-ethylidene-16,17,18-trihydroxy-9-oxo-2,4,10,13,19-pentaoxatricyclo[13.3.1.13,7]icos-5-ene-6-carboxylate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.24% | 91.49% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.27% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.18% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.97% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.00% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.91% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.89% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.85% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.85% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.08% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.51% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.44% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.34% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.51% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.16% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.86% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jasminum grandiflorum |
PubChem | 11972585 |
LOTUS | LTS0190341 |
wikiData | Q105228938 |