2-[(E)-4-hydroxy-3-methylbut-2-enyl]guanidine
| Internal ID | d6fa3469-1978-404c-8f5d-629d7cbd78e0 |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Guanidines |
| IUPAC Name | 2-[(E)-4-hydroxy-3-methylbut-2-enyl]guanidine |
| SMILES (Canonical) | CC(=CCN=C(N)N)CO |
| SMILES (Isomeric) | C/C(=C\CN=C(N)N)/CO |
| InChI | InChI=1S/C6H13N3O/c1-5(4-10)2-3-9-6(7)8/h2,10H,3-4H2,1H3,(H4,7,8,9)/b5-2+ |
| InChI Key | YEVAUEKXKYEZAL-GORDUTHDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.105862047 g/mol |
| Topological Polar Surface Area (TPSA) | 84.60 Ų |
| XlogP | -0.90 |
| There are no found synonyms. |
![2D Structure of 2-[(E)-4-hydroxy-3-methylbut-2-enyl]guanidine](https://plantaedb.com/storage/docs/compounds/2023/11/2-e-4-hydroxy-3-methylbut-2-enylguanidine.jpg "2D Structure of 2-[(E)-4-hydroxy-3-methylbut-2-enyl]guanidine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 93.38% | 97.88% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.40% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.16% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.54% | 89.34% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 81.19% | 87.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Galega officinalis |
| PubChem | 21765894 |
| LOTUS | LTS0072664 |
| wikiData | Q105347418 |