2-Benzyl-4,6-dihydroxybenzoic acid
Internal ID | 34e1325d-8d01-4909-8fc9-e90039ba5868 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylmethanes |
IUPAC Name | 2-benzyl-4,6-dihydroxybenzoic acid |
SMILES (Canonical) | C1=CC=C(C=C1)CC2=C(C(=CC(=C2)O)O)C(=O)O |
SMILES (Isomeric) | C1=CC=C(C=C1)CC2=C(C(=CC(=C2)O)O)C(=O)O |
InChI | InChI=1S/C14H12O4/c15-11-7-10(6-9-4-2-1-3-5-9)13(14(17)18)12(16)8-11/h1-5,7-8,15-16H,6H2,(H,17,18) |
InChI Key | JJZORPAULBCJKE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H12O4 |
Molecular Weight | 244.24 g/mol |
Exact Mass | 244.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 3.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.71% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.15% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.03% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.23% | 95.50% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.91% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.84% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.76% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.77% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 83.71% | 90.71% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.47% | 94.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.30% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.02% | 90.00% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 80.62% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senna obtusifolia |
PubChem | 162881997 |
LOTUS | LTS0239269 |
wikiData | Q105130074 |