2-(Benzoylamino)benzoic acid
| Internal ID | ba7da7dc-c814-47b2-93bb-fe2202cb82ed |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzoic acids |
| IUPAC Name | 2-benzamidobenzoic acid |
| SMILES (Canonical) | C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2C(=O)O |
| SMILES (Isomeric) | C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2C(=O)O |
| InChI | InChI=1S/C14H11NO3/c16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18/h1-9H,(H,15,16)(H,17,18) |
| InChI Key | WXVLIIDDWFGYCV-UHFFFAOYSA-N |
| Popularity | 53 references in papers |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 66.40 Ų |
| XlogP | 3.50 |
| 579-93-1 |
| 2-benzamidobenzoic acid |
| dianthramid B |
| N-Benzoylanthranilic acid |
| Benzoic acid, 2-(benzoylamino)- |
| 2'-Carboxybenzanilide |
| 2-Benzoylamino-benzoic acid |
| Benzoylanthranilic acid |
| Anthranilic acid, N-benzoyl- |
| N-(2-Carboxyphenyl)benzamide |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 99.67% | 87.67% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 98.91% | 81.11% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.54% | 89.34% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.14% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.02% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.49% | 98.75% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.14% | 93.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.40% | 99.23% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 86.92% | 85.83% |
| CHEMBL4901 | P54753 | Ephrin type-B receptor 3 | 84.70% | 87.50% |
| CHEMBL5847 | P52895 | Aldo-keto reductase family 1 member C2 | 83.25% | 92.50% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.22% | 97.36% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.02% | 94.62% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.97% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dianthus caryophyllus |
| PubChem | 68482 |
| LOTUS | LTS0207051 |
| wikiData | Q27121845 |