2-Amino-3-(3-carboxy-4-hydroxyphenyl)propanoic acid
| Internal ID | 7477beaa-bdf8-4a2d-9052-c5a2cb371b4d |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Tyrosine and derivatives |
| IUPAC Name | 5-(2-amino-2-carboxyethyl)-2-hydroxybenzoic acid |
| SMILES (Canonical) | C1=CC(=C(C=C1CC(C(=O)O)N)C(=O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1CC(C(=O)O)N)C(=O)O)O |
| InChI | InChI=1S/C10H11NO5/c11-7(10(15)16)4-5-1-2-8(12)6(3-5)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)(H,15,16) |
| InChI Key | AZXBADPWXOWMKQ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06372245 g/mol |
| Topological Polar Surface Area (TPSA) | 121.00 Ų |
| XlogP | -2.30 |
| 2-amino-3-(3-carboxy-4-hydroxyphenyl)propanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.06% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.51% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.96% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.95% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.62% | 99.15% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.28% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.71% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.50% | 94.45% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 88.49% | 92.29% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.31% | 95.50% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 85.60% | 94.42% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.03% | 95.56% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.39% | 90.24% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.24% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.73% | 97.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.64% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 80.73% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Caylusea abyssinica |
| Lunaria annua |
| Reseda luteola |
| PubChem | 583884 |
| LOTUS | LTS0209102 |
| wikiData | Q104921985 |