2-Acetyl-1-methylpyrrole
| Internal ID | fe959d39-b238-4c3a-93d5-db175ed0b8c6 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aryl ketones > Aryl alkyl ketones |
| IUPAC Name | 1-(1-methylpyrrol-2-yl)ethanone |
| SMILES (Canonical) | CC(=O)C1=CC=CN1C |
| SMILES (Isomeric) | CC(=O)C1=CC=CN1C |
| InChI | InChI=1S/C7H9NO/c1-6(9)7-4-3-5-8(7)2/h3-5H,1-2H3 |
| InChI Key | NZFLWVDXYUGFAV-UHFFFAOYSA-N |
| Popularity | 34 references in papers |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.068413911 g/mol |
| Topological Polar Surface Area (TPSA) | 22.00 Ų |
| XlogP | 0.70 |
| 932-16-1 |
| 1-(1-Methyl-1H-pyrrol-2-yl)ethanone |
| 1-(1-Methylpyrrol-2-yl)ethanone |
| 1-Methyl-2-acetylpyrrole |
| 2-Acetyl-N-methylpyrrole |
| 1-(1-Methyl-1H-pyrrol-2-yl)ethan-1-one |
| ETHANONE, 1-(1-METHYL-1H-PYRROL-2-YL)- |
| Methyl 1-methylpyrrol-2-yl ketone |
| 2-acetyl-1-methyl pyrrole |
| FEMA No. 3184 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.98% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.26% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.76% | 98.95% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.61% | 93.65% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.37% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Coffea arabica |
| PubChem | 61240 |
| LOTUS | LTS0210553 |
| wikiData | Q27127006 |