2-[6-(2-Hydroxy-2-phenylethyl)piperidin-2-yl]-1-phenylethanol
| Internal ID | e8520367-8656-4e9a-93a5-1e5037d330be |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Amines > Aralkylamines |
| IUPAC Name | 2-[6-(2-hydroxy-2-phenylethyl)piperidin-2-yl]-1-phenylethanol |
| SMILES (Canonical) | C1CC(NC(C1)CC(C2=CC=CC=C2)O)CC(C3=CC=CC=C3)O |
| SMILES (Isomeric) | C1CC(NC(C1)CC(C2=CC=CC=C2)O)CC(C3=CC=CC=C3)O |
| InChI | InChI=1S/C21H27NO2/c23-20(16-8-3-1-4-9-16)14-18-12-7-13-19(22-18)15-21(24)17-10-5-2-6-11-17/h1-6,8-11,18-24H,7,12-15H2 |
| InChI Key | UMXDEQATKLAHCQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.204179104 g/mol |
| Topological Polar Surface Area (TPSA) | 52.50 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of 2-[6-(2-Hydroxy-2-phenylethyl)piperidin-2-yl]-1-phenylethanol](https://plantaedb.com/storage/docs/compounds/2023/11/2-6-2-hydroxy-2-phenylethylpiperidin-2-yl-1-phenylethanol.jpg "2D Structure of 2-[6-(2-Hydroxy-2-phenylethyl)piperidin-2-yl]-1-phenylethanol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.47% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.29% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.27% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.16% | 97.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.16% | 94.62% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 88.85% | 93.81% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.51% | 90.17% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.50% | 94.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.10% | 95.56% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.67% | 94.08% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.80% | 95.56% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.65% | 95.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.54% | 94.45% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.21% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.46% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lobelia inflata |
| Lobelia polyphylla |
| PubChem | 418318 |
| LOTUS | LTS0045067 |
| wikiData | Q105275798 |