2-(4-Methoxy-3-prop-1-enylphenyl)-4-prop-1-enylphenol
| Internal ID | eeeac1e6-0e05-4a20-bb14-bb17a2f37e96 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
| IUPAC Name | 2-(4-methoxy-3-prop-1-enylphenyl)-4-prop-1-enylphenol |
| SMILES (Canonical) | CC=CC1=CC(=C(C=C1)O)C2=CC(=C(C=C2)OC)C=CC |
| SMILES (Isomeric) | CC=CC1=CC(=C(C=C1)O)C2=CC(=C(C=C2)OC)C=CC |
| InChI | InChI=1S/C19H20O2/c1-4-6-14-8-10-18(20)17(12-14)15-9-11-19(21-3)16(13-15)7-5-2/h4-13,20H,1-3H3 |
| InChI Key | YHPOEIHWYRUVKC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.70% | 91.49% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 96.34% | 98.11% |
| CHEMBL3194 | P02766 | Transthyretin | 96.30% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.26% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.14% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.10% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.50% | 96.09% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 91.31% | 93.31% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 90.17% | 98.35% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.98% | 88.48% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.22% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.84% | 95.56% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.92% | 96.12% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.14% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.55% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.54% | 89.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 84.27% | 95.12% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.09% | 98.75% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 83.66% | 80.78% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.63% | 95.50% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.44% | 90.20% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.97% | 90.24% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.63% | 94.75% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.65% | 91.71% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.22% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Magnolia obovata |
| PubChem | 163043531 |
| LOTUS | LTS0240412 |
| wikiData | Q105348549 |