[2-(4-Hydroxyphenyl)naphthalene-1-carbonyl] 2-(4-hydroxyphenyl)naphthalene-1-carboxylate
| Internal ID | 6f4a9b70-58ec-4493-8319-142327cf5051 |
| Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
| IUPAC Name | [2-(4-hydroxyphenyl)naphthalene-1-carbonyl] 2-(4-hydroxyphenyl)naphthalene-1-carboxylate |
| SMILES (Canonical) | C1=CC=C2C(=C1)C=CC(=C2C(=O)OC(=O)C3=C(C=CC4=CC=CC=C43)C5=CC=C(C=C5)O)C6=CC=C(C=C6)O |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C=CC(=C2C(=O)OC(=O)C3=C(C=CC4=CC=CC=C43)C5=CC=C(C=C5)O)C6=CC=C(C=C6)O |
| InChI | InChI=1S/C34H22O5/c35-25-15-9-23(10-16-25)29-19-13-21-5-1-3-7-27(21)31(29)33(37)39-34(38)32-28-8-4-2-6-22(28)14-20-30(32)24-11-17-26(36)18-12-24/h1-20,35-36H |
| InChI Key | XBOYRYVAZNRERX-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C34H22O5 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 8.30 |
| There are no found synonyms. |
![2D Structure of [2-(4-Hydroxyphenyl)naphthalene-1-carbonyl] 2-(4-hydroxyphenyl)naphthalene-1-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/2-4-hydroxyphenylnaphthalene-1-carbonyl-2-4-hydroxyphenylnaphthalene-1-carboxylate.jpg "2D Structure of [2-(4-Hydroxyphenyl)naphthalene-1-carbonyl] 2-(4-hydroxyphenyl)naphthalene-1-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.03% | 91.11% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.12% | 91.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.03% | 98.95% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 89.78% | 98.35% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.44% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.75% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.02% | 99.23% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 84.57% | 92.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.29% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.07% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.05% | 99.17% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 81.85% | 97.53% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.33% | 86.33% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.81% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.56% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.02% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Musa × paradisiaca |
| Musa acuminata |
| PubChem | 129847944 |
| LOTUS | LTS0085392 |
| wikiData | Q105324618 |