2-(4-hydroxy-3,5-dimethoxyphenyl)-5-[2-(3-hydroxyphenyl)ethyl]-7-methoxy-3,4-dihydro-2H-chromen-3-ol
| Internal ID | 7ea74e1b-66e6-485a-984a-e4c42be643b6 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
| IUPAC Name | 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-[2-(3-hydroxyphenyl)ethyl]-7-methoxy-3,4-dihydro-2H-chromen-3-ol |
| SMILES (Canonical) | COC1=CC(=C2CC(C(OC2=C1)C3=CC(=C(C(=C3)OC)O)OC)O)CCC4=CC(=CC=C4)O |
| SMILES (Isomeric) | COC1=CC(=C2CC(C(OC2=C1)C3=CC(=C(C(=C3)OC)O)OC)O)CCC4=CC(=CC=C4)O |
| InChI | InChI=1S/C26H28O7/c1-30-19-10-16(8-7-15-5-4-6-18(27)9-15)20-14-21(28)26(33-22(20)13-19)17-11-23(31-2)25(29)24(12-17)32-3/h4-6,9-13,21,26-29H,7-8,14H2,1-3H3 |
| InChI Key | WDWBDTMIXFXVMO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H28O7 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 97.60 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.26% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.95% | 91.11% |
| CHEMBL240 | Q12809 | HERG | 98.05% | 89.76% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.50% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.03% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.67% | 86.33% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 94.11% | 95.55% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.47% | 97.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.59% | 92.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.53% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.86% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.52% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.51% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.20% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.76% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.75% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.52% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.12% | 99.15% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.29% | 99.18% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.84% | 90.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.23% | 93.99% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.91% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pleione bulbocodioides |
| PubChem | 162855753 |
| LOTUS | LTS0212936 |
| wikiData | Q105302718 |