2-(4-Hydroperoxy-4-methylcyclohex-2-en-1-yl)propan-2-yl acetate
Internal ID | 48dcb9e5-e878-485d-991c-516ebbc4a5de |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Menthane monoterpenoids |
IUPAC Name | 2-(4-hydroperoxy-4-methylcyclohex-2-en-1-yl)propan-2-yl acetate |
SMILES (Canonical) | CC(=O)OC(C)(C)C1CCC(C=C1)(C)OO |
SMILES (Isomeric) | CC(=O)OC(C)(C)C1CCC(C=C1)(C)OO |
InChI | InChI=1S/C12H20O4/c1-9(13)15-11(2,3)10-5-7-12(4,16-14)8-6-10/h5,7,10,14H,6,8H2,1-4H3 |
InChI Key | VIUQTXYGNHOJBD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H20O4 |
Molecular Weight | 228.28 g/mol |
Exact Mass | 228.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 1.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.75% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.49% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.56% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.02% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 86.97% | 98.95% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.83% | 93.04% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.69% | 89.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.57% | 92.94% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.48% | 85.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.44% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.48% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.94% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.30% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.26% | 100.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.32% | 95.71% |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 80.21% | 98.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Laurus nobilis |
PubChem | 72974200 |
LOTUS | LTS0202848 |
wikiData | Q105287034 |