2-[4-[2-(3,5-Dihydroxyphenyl)ethenyl]-3-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 804b7f8f-ef31-41d7-a162-f0bb2e3fedb9 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes > Stilbene glycosides |
IUPAC Name | 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]-3-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | C1=CC(=C(C=C1OC2C(C(C(C(O2)CO)O)O)O)O)C=CC3=CC(=CC(=C3)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1OC2C(C(C(C(O2)CO)O)O)O)O)C=CC3=CC(=CC(=C3)O)O |
InChI | InChI=1S/C20H22O9/c21-9-16-17(25)18(26)19(27)20(29-16)28-14-4-3-11(15(24)8-14)2-1-10-5-12(22)7-13(23)6-10/h1-8,16-27H,9H2 |
InChI Key | QNJXAEVGLMVYJF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O9 |
Molecular Weight | 406.40 g/mol |
Exact Mass | 406.12638228 g/mol |
Topological Polar Surface Area (TPSA) | 160.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of 2-[4-[2-(3,5-Dihydroxyphenyl)ethenyl]-3-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of 2-[4-[2-(3,5-Dihydroxyphenyl)ethenyl]-3-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/2-4-2-35-dihydroxyphenylethenyl-3-hydroxyphenoxy-6-hydroxymethyloxane-345-triol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.95% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 95.14% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.56% | 96.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.16% | 95.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.49% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.44% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.34% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.02% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.62% | 86.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.40% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.99% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.72% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.60% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.63% | 99.15% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 85.99% | 83.57% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.92% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.82% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.54% | 95.83% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.44% | 95.89% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.38% | 91.71% |
CHEMBL2581 | P07339 | Cathepsin D | 82.87% | 98.95% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 81.24% | 88.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Veratrum dahuricum |
PubChem | 162991614 |
LOTUS | LTS0077888 |
wikiData | Q105224512 |