2-(3,5-dimethoxyphenyl)-6-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-5,7-diol
Internal ID | 40e598cb-72e9-4ea8-8ff7-5d46b18b20f9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 6-prenylated flavans |
IUPAC Name | 2-(3,5-dimethoxyphenyl)-6-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-5,7-diol |
SMILES (Canonical) | CC(=CCC1=C(C2=C(C=C1O)OC(CC2)C3=CC(=CC(=C3)OC)OC)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C2=C(C=C1O)OC(CC2)C3=CC(=CC(=C3)OC)OC)O)C |
InChI | InChI=1S/C22H26O5/c1-13(2)5-6-17-19(23)12-21-18(22(17)24)7-8-20(27-21)14-9-15(25-3)11-16(10-14)26-4/h5,9-12,20,23-24H,6-8H2,1-4H3 |
InChI Key | LLRPPTLVKGWPCU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H26O5 |
Molecular Weight | 370.40 g/mol |
Exact Mass | 370.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 5.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.82% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.87% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.59% | 94.45% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 91.07% | 92.68% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.36% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.57% | 92.94% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.49% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.44% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.92% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.91% | 92.62% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.04% | 93.99% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.61% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.62% | 99.15% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.60% | 88.48% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.65% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.55% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.30% | 91.49% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.26% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.91% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 80.75% | 98.95% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 80.06% | 96.12% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyperus conglomeratus |
PubChem | 10832955 |
LOTUS | LTS0038898 |
wikiData | Q105153688 |