[2-(3,4-Dimethoxy-6-oxo-1-prop-2-enylcyclohexa-2,4-dien-1-yl)-1-(3,4-dimethoxyphenyl)propyl] acetate
| Internal ID | 1c620eb6-6f0f-4a3a-b93c-b6c09342e1fa |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | [2-(3,4-dimethoxy-6-oxo-1-prop-2-enylcyclohexa-2,4-dien-1-yl)-1-(3,4-dimethoxyphenyl)propyl] acetate |
| SMILES (Canonical) | CC(C(C1=CC(=C(C=C1)OC)OC)OC(=O)C)C2(C=C(C(=CC2=O)OC)OC)CC=C |
| SMILES (Isomeric) | CC(C(C1=CC(=C(C=C1)OC)OC)OC(=O)C)C2(C=C(C(=CC2=O)OC)OC)CC=C |
| InChI | InChI=1S/C24H30O7/c1-8-11-24(14-21(30-7)20(29-6)13-22(24)26)15(2)23(31-16(3)25)17-9-10-18(27-4)19(12-17)28-5/h8-10,12-15,23H,1,11H2,2-7H3 |
| InChI Key | SVCDSCSVRZHKRQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H30O7 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19915329 g/mol |
| Topological Polar Surface Area (TPSA) | 80.30 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of [2-(3,4-Dimethoxy-6-oxo-1-prop-2-enylcyclohexa-2,4-dien-1-yl)-1-(3,4-dimethoxyphenyl)propyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/2-34-dimethoxy-6-oxo-1-prop-2-enylcyclohexa-24-dien-1-yl-1-34-dimethoxyphenylpropyl-acetate.jpg "2D Structure of [2-(3,4-Dimethoxy-6-oxo-1-prop-2-enylcyclohexa-2,4-dien-1-yl)-1-(3,4-dimethoxyphenyl)propyl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.54% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.45% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.76% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.64% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.76% | 90.20% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.30% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.77% | 85.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.97% | 96.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.49% | 91.07% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.43% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.81% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.32% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.21% | 99.17% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.18% | 94.75% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.10% | 89.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.76% | 91.19% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.40% | 89.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.83% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.91% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.05% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper kadsura |
| PubChem | 72989180 |
| LOTUS | LTS0042122 |
| wikiData | Q105261795 |