2-[(3,4-Dihydroxyphenyl)methylidene]-6-hydroxy-5-(3-methylbut-2-enyl)-1-benzofuran-3-one
Internal ID | 9a4017f5-09a2-4a2f-9332-f7e413f6fb26 |
Taxonomy | Phenylpropanoids and polyketides > Aurone flavonoids |
IUPAC Name | 2-[(3,4-dihydroxyphenyl)methylidene]-6-hydroxy-5-(3-methylbut-2-enyl)-1-benzofuran-3-one |
SMILES (Canonical) | CC(=CCC1=CC2=C(C=C1O)OC(=CC3=CC(=C(C=C3)O)O)C2=O)C |
SMILES (Isomeric) | CC(=CCC1=CC2=C(C=C1O)OC(=CC3=CC(=C(C=C3)O)O)C2=O)C |
InChI | InChI=1S/C20H18O5/c1-11(2)3-5-13-9-14-18(10-16(13)22)25-19(20(14)24)8-12-4-6-15(21)17(23)7-12/h3-4,6-10,21-23H,5H2,1-2H3 |
InChI Key | NYCBUBKYUALZIH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H18O5 |
Molecular Weight | 338.40 g/mol |
Exact Mass | 338.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 4.50 |
There are no found synonyms. |
![2D Structure of 2-[(3,4-Dihydroxyphenyl)methylidene]-6-hydroxy-5-(3-methylbut-2-enyl)-1-benzofuran-3-one 2D Structure of 2-[(3,4-Dihydroxyphenyl)methylidene]-6-hydroxy-5-(3-methylbut-2-enyl)-1-benzofuran-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-34-dihydroxyphenylmethylidene-6-hydroxy-5-3-methylbut-2-enyl-1-benzofuran-3-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.39% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 96.39% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.74% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.31% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.89% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.61% | 86.33% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 90.55% | 96.12% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.14% | 96.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.89% | 94.80% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.79% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.46% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.36% | 99.23% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.50% | 80.78% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.35% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.90% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Broussonetia papyrifera |
PubChem | 73191348 |
LOTUS | LTS0185741 |
wikiData | Q105187444 |